C15H24BrNO — CID 55099187
1-(3-bromophenyl)-3-[methyl(pentan-2-yl)amino]propan-1-ol (PubChem CID 55099187) has the molecular formula C15H24BrNO and a molecular weight of 314.27 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[methyl(pentan-2-yl)amino]propan-1-ol.
| Compound Name | 1-(3-bromophenyl)-3-[methyl(pentan-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 55099187 |
| Molecular Formula | C15H24BrNO |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-(3-bromophenyl)-3-[methyl(pentan-2-yl)amino]propan-1-ol |
| SMILES | CCCC(C)N(C)CCC(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H24BrNO/c1-4-6-12(2)17(3)10-9-15(18)13-7-5-8-14(16)11-13/h5,7-8,11-12,15,18H,4,6,9-10H2,1-3H3 |
| InChIKey | FGPRUESFPNZWCF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |