C21H25BrClNO3 — CID 91503126
2-(4-bromophenyl)ethyl N-tert-butyl-N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamate (PubChem CID 91503126) has the molecular formula C21H25BrClNO3 and a molecular weight of 454.79 g/mol. Its IUPAC name is 2-(4-bromophenyl)ethyl N-tert-butyl-N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamate.
| Compound Name | 2-(4-bromophenyl)ethyl N-tert-butyl-N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 91503126 |
| Molecular Formula | C21H25BrClNO3 |
| Molecular Weight | 454.79 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 2-(4-bromophenyl)ethyl N-tert-butyl-N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamate |
| SMILES | CC(C)(C)N(C[C@H](O)c1cccc(Cl)c1)C(=O)OCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H25BrClNO3/c1-21(2,3)24(14-19(25)16-5-4-6-18(23)13-16)20(26)27-12-11-15-7-9-17(22)10-8-15/h4-10,13,19,25H,11-12,14H2,1-3H3/t19-/m0/s1 |
| InChIKey | WKGIMIPGODPSCL-IBGZPJMESA-N |
| XLogP | 5.62 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.79 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |