C9H10ClNO3 — CID 2762309
(2S,3S)-3-amino-3-(3-chlorophenyl)-2-hydroxypropanoic acid (PubChem CID 2762309) has the molecular formula C9H10ClNO3 and a molecular weight of 215.64 g/mol. Its IUPAC name is (2S,3S)-3-amino-3-(3-chlorophenyl)-2-hydroxypropanoic acid.
| Compound Name | (2S,3S)-3-amino-3-(3-chlorophenyl)-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 2762309 |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (2S,3S)-3-amino-3-(3-chlorophenyl)-2-hydroxypropanoic acid |
| SMILES | N[C@@H](c1cccc(Cl)c1)[C@H](O)C(=O)O |
| InChI | InChI=1S/C9H10ClNO3/c10-6-3-1-2-5(4-6)7(11)8(12)9(13)14/h1-4,7-8,12H,11H2,(H,13,14)/t7-,8-/m0/s1 |
| InChIKey | NNWYKVQWHGHCQY-YUMQZZPRSA-N |
| XLogP | 0.79 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |