C10H15NO3 — CID 159519060
(2S,3S)-3-amino-2-hydroxy-3-phenylpropanoic acid;methane (PubChem CID 159519060) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (2S,3S)-3-amino-2-hydroxy-3-phenylpropanoic acid;methane.
| Compound Name | (2S,3S)-3-amino-2-hydroxy-3-phenylpropanoic acid;methane |
|---|---|
| PubChem CID | 159519060 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (2S,3S)-3-amino-2-hydroxy-3-phenylpropanoic acid;methane |
| SMILES | C.N[C@@H](c1ccccc1)[C@H](O)C(=O)O |
| InChI | InChI=1S/C9H11NO3.CH4/c10-7(8(11)9(12)13)6-4-2-1-3-5-6;/h1-5,7-8,11H,10H2,(H,12,13);1H4/t7-,8-;/m0./s1 |
| InChIKey | MBOOTMSILAJLGG-WSZWBAFRSA-N |
| XLogP | 0.77 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |