C8H9NO2 — CID 71309299
(2R)-2-amino-2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)acetic acid (PubChem CID 71309299) has the molecular formula C8H9NO2 and a molecular weight of 157.12 g/mol. Its IUPAC name is (2R)-2-amino-2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)acetic acid.
| Compound Name | (2R)-2-amino-2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)acetic acid |
|---|---|
| PubChem CID | 71309299 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.08 |
| IUPAC Name | (2R)-2-amino-2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)acetic acid |
| SMILES | N[C@@H](C(=O)O)[13c]1[13cH][13cH][13cH][13cH][13cH]1 |
| InChI | InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11)/t7-/m1/s1/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | ZGUNAGUHMKGQNY-MXCTURFOSA-N |
| XLogP | 0.77 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |