C17H20N2O4 — CID 70231185
(2R)-2-amino-2-phenylacetic acid;2-(N-methylanilino)acetic acid (PubChem CID 70231185) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (2R)-2-amino-2-phenylacetic acid;2-(N-methylanilino)acetic acid.
| Compound Name | (2R)-2-amino-2-phenylacetic acid;2-(N-methylanilino)acetic acid |
|---|---|
| PubChem CID | 70231185 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (2R)-2-amino-2-phenylacetic acid;2-(N-methylanilino)acetic acid |
| SMILES | CN(CC(=O)O)c1ccccc1.N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C9H11NO2.C8H9NO2/c1-10(7-9(11)12)8-5-3-2-4-6-8;9-7(8(10)11)6-4-2-1-3-5-6/h2-6H,7H2,1H3,(H,11,12);1-5,7H,9H2,(H,10,11)/t;7-/m.1/s1 |
| InChIKey | JHLAFBXJPSQXHP-HMZWWLAASA-N |
| XLogP | 1.98 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |