C10H14N2O — CID 11263835
(2S)-2-amino-N,N-dimethyl-2-phenylacetamide (PubChem CID 11263835) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (2S)-2-amino-N,N-dimethyl-2-phenylacetamide.
| Compound Name | (2S)-2-amino-N,N-dimethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 11263835 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (2S)-2-amino-N,N-dimethyl-2-phenylacetamide |
| SMILES | CN(C)C(=O)[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C10H14N2O/c1-12(2)10(13)9(11)8-6-4-3-5-7-8/h3-7,9H,11H2,1-2H3/t9-/m0/s1 |
| InChIKey | FYEBKMCUIFSZNT-VIFPVBQESA-N |
| XLogP | 0.77 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |