C32H34N2O2 — CID 19693860
N,N-dimethyl-2,2-diphenylacetamide (PubChem CID 19693860) has the molecular formula C32H34N2O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is N,N-dimethyl-2,2-diphenylacetamide.
| Compound Name | N,N-dimethyl-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 19693860 |
| Molecular Formula | C32H34N2O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | N,N-dimethyl-2,2-diphenylacetamide |
| SMILES | CN(C)C(=O)C(c1ccccc1)c1ccccc1.CN(C)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C16H17NO/c2*1-17(2)16(18)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h2*3-12,15H,1-2H3 |
| InChIKey | WMIPWRSVIZFVQB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |