C19H21NO3 — CID 70599028
N,N-dimethyl-2,2-diphenylacetamide;prop-2-enoic acid (PubChem CID 70599028) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is N,N-dimethyl-2,2-diphenylacetamide;prop-2-enoic acid.
| Compound Name | N,N-dimethyl-2,2-diphenylacetamide;prop-2-enoic acid |
|---|---|
| PubChem CID | 70599028 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N,N-dimethyl-2,2-diphenylacetamide;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CN(C)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO.C3H4O2/c1-17(2)16(18)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-2-3(4)5/h3-12,15H,1-2H3;2H,1H2,(H,4,5) |
| InChIKey | DQQMPBHPOWCEPQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|