C12H16ClNO2 — CID 161381128
1-chloro-N,N-dimethyl-1-phenylmethanamine;prop-2-enoic acid (PubChem CID 161381128) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 1-chloro-N,N-dimethyl-1-phenylmethanamine;prop-2-enoic acid.
| Compound Name | 1-chloro-N,N-dimethyl-1-phenylmethanamine;prop-2-enoic acid |
|---|---|
| PubChem CID | 161381128 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-chloro-N,N-dimethyl-1-phenylmethanamine;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CN(C)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C9H12ClN.C3H4O2/c1-11(2)9(10)8-6-4-3-5-7-8;1-2-3(4)5/h3-7,9H,1-2H3;2H,1H2,(H,4,5) |
| InChIKey | VRSUXVLKQBWSHY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|