C6H13NO2 — CID 87439346
N,N-dimethylmethanamine;prop-2-enoic acid (PubChem CID 87439346) has the molecular formula C6H13NO2 and a molecular weight of 131.17 g/mol. Its IUPAC name is N,N-dimethylmethanamine;prop-2-enoic acid.
| Compound Name | N,N-dimethylmethanamine;prop-2-enoic acid |
|---|---|
| PubChem CID | 87439346 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | N,N-dimethylmethanamine;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CN(C)C |
| InChI | InChI=1S/C3H9N.C3H4O2/c1-4(2)3;1-2-3(4)5/h1-3H3;2H,1H2,(H,4,5) |
| InChIKey | ZYASLVDNDXUOMI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|