About azane;prop-2-enoic acid
azane;prop-2-enoic acid (PubChem CID 173158019) has the molecular formula C3H25N7O2
and a molecular weight of 191.28 g/mol. Its IUPAC name is azane;prop-2-enoic acid.
Molecular Properties
| Compound Name | azane;prop-2-enoic acid |
| PubChem CID | 173158019 |
| Molecular Formula | C3H25N7O2 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.21 |
| IUPAC Name | azane;prop-2-enoic acid |
| SMILES | C=CC(=O)O.N.N.N.N.N.N.N |
| InChI | InChI=1S/C3H4O2.7H3N/c1-2-3(4)5;;;;;;;/h2H,1H2,(H,4,5);7*1H3 |
| InChIKey | BFUOIPSKEITXNN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 282.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;prop-2-enoic acid?
The IUPAC name of azane;prop-2-enoic acid (CID 173158019) is azane;prop-2-enoic acid.
What is the SMILES notation for azane;prop-2-enoic acid?
The canonical SMILES for azane;prop-2-enoic acid is C=CC(=O)O.N.N.N.N.N.N.N.
What is the InChIKey of azane;prop-2-enoic acid?
The InChIKey is BFUOIPSKEITXNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.7H3N/c1-2-3(4)5;;;;;;;/h2H,1H2,(H,4,5);7*1H3.
What are the key properties of azane;prop-2-enoic acid?
azane;prop-2-enoic acid has a molecular weight of 191.28 g/mol, XLogP of 1.39, 1 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for azane;prop-2-enoic acid is sourced from PubChem (CID 173158019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).