About calcium;prop-2-enoic acid;dichloride
calcium;prop-2-enoic acid;dichloride (PubChem CID 172857747) has the molecular formula C3H4CaCl2O2
and a molecular weight of 183.05 g/mol. Its IUPAC name is calcium;prop-2-enoic acid;dichloride.
Molecular Properties
| Compound Name | calcium;prop-2-enoic acid;dichloride |
| PubChem CID | 172857747 |
| Molecular Formula | C3H4CaCl2O2 |
| Molecular Weight | 183.05 g/mol |
| Exact Mass | 181.92 |
| IUPAC Name | calcium;prop-2-enoic acid;dichloride |
| SMILES | C=CC(=O)O.[Ca+2].[Cl-].[Cl-] |
| InChI | InChI=1S/C3H4O2.Ca.2ClH/c1-2-3(4)5;;;/h2H,1H2,(H,4,5);;2*1H/q;+2;;/p-2 |
| InChIKey | YYEQHIXJBSSBJU-UHFFFAOYSA-L |
| XLogP | -6.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.05 |
| LogP ≤ 5 | -6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze calcium;prop-2-enoic acid;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;prop-2-enoic acid;dichloride?
The IUPAC name of calcium;prop-2-enoic acid;dichloride (CID 172857747) is calcium;prop-2-enoic acid;dichloride.
What is the SMILES notation for calcium;prop-2-enoic acid;dichloride?
The canonical SMILES for calcium;prop-2-enoic acid;dichloride is C=CC(=O)O.[Ca+2].[Cl-].[Cl-].
What is the InChIKey of calcium;prop-2-enoic acid;dichloride?
The InChIKey is YYEQHIXJBSSBJU-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H4O2.Ca.2ClH/c1-2-3(4)5;;;/h2H,1H2,(H,4,5);;2*1H/q;+2;;/p-2.
What are the key properties of calcium;prop-2-enoic acid;dichloride?
calcium;prop-2-enoic acid;dichloride has a molecular weight of 183.05 g/mol, XLogP of -6.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;prop-2-enoic acid;dichloride is sourced from PubChem (CID 172857747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).