About prop-2-enoic acid;hydrochloride
prop-2-enoic acid;hydrochloride (PubChem CID 22354205) has the molecular formula C3H5ClO2
and a molecular weight of 108.52 g/mol. Its IUPAC name is prop-2-enoic acid;hydrochloride.
Molecular Properties
| Compound Name | prop-2-enoic acid;hydrochloride |
| PubChem CID | 22354205 |
| Molecular Formula | C3H5ClO2 |
| Molecular Weight | 108.52 g/mol |
| Exact Mass | 108.00 |
| IUPAC Name | prop-2-enoic acid;hydrochloride |
| SMILES | C=CC(=O)O.Cl |
| InChI | InChI=1S/C3H4O2.ClH/c1-2-3(4)5;/h2H,1H2,(H,4,5);1H |
| InChIKey | NPSSWQJHYLDCNV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.52 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoic acid;hydrochloride?
The IUPAC name of prop-2-enoic acid;hydrochloride (CID 22354205) is prop-2-enoic acid;hydrochloride.
What is the SMILES notation for prop-2-enoic acid;hydrochloride?
The canonical SMILES for prop-2-enoic acid;hydrochloride is C=CC(=O)O.Cl.
What is the InChIKey of prop-2-enoic acid;hydrochloride?
The InChIKey is NPSSWQJHYLDCNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.ClH/c1-2-3(4)5;/h2H,1H2,(H,4,5);1H.
What are the key properties of prop-2-enoic acid;hydrochloride?
prop-2-enoic acid;hydrochloride has a molecular weight of 108.52 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoic acid;hydrochloride is sourced from PubChem (CID 22354205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).