N-phenylaniline;prop-2-enoic acid

C15H15NO2 — CID 160759599

IUPACN-phenylaniline;prop-2-enoic acid
SMILESC=CC(=O)O.c1ccc(Nc2ccccc2)cc1
InChIInChI=1S/C12H11N.C3H4O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3(4)5/h1-10,13H;2H,1H2,(H,4,5)
InChIKeyRXWQJLHSPTVYLE-UHFFFAOYSA-N
MW241.29 g/mol
LogP3.69
Rot. Bonds3

About N-phenylaniline;prop-2-enoic acid

N-phenylaniline;prop-2-enoic acid (PubChem CID 160759599) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is N-phenylaniline;prop-2-enoic acid.

Molecular Properties

Compound NameN-phenylaniline;prop-2-enoic acid
PubChem CID160759599
Molecular FormulaC15H15NO2
Molecular Weight241.29 g/mol
Exact Mass241.11
IUPAC NameN-phenylaniline;prop-2-enoic acid
SMILESC=CC(=O)O.c1ccc(Nc2ccccc2)cc1
InChIInChI=1S/C12H11N.C3H4O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3(4)5/h1-10,13H;2H,1H2,(H,4,5)
InChIKeyRXWQJLHSPTVYLE-UHFFFAOYSA-N
XLogP3.69
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.29
LogP ≤ 53.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze N-phenylaniline;prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-phenylaniline;prop-2-enoic acid?
The IUPAC name of N-phenylaniline;prop-2-enoic acid (CID 160759599) is N-phenylaniline;prop-2-enoic acid.
What is the SMILES notation for N-phenylaniline;prop-2-enoic acid?
The canonical SMILES for N-phenylaniline;prop-2-enoic acid is C=CC(=O)O.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of N-phenylaniline;prop-2-enoic acid?
The InChIKey is RXWQJLHSPTVYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C3H4O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3(4)5/h1-10,13H;2H,1H2,(H,4,5).
What are the key properties of N-phenylaniline;prop-2-enoic acid?
N-phenylaniline;prop-2-enoic acid has a molecular weight of 241.29 g/mol, XLogP of 3.69, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylaniline;prop-2-enoic acid is sourced from PubChem (CID 160759599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).