About benzene;phenol;prop-2-enoic acid
benzene;phenol;prop-2-enoic acid (PubChem CID 174875932) has the molecular formula C15H16O3
and a molecular weight of 244.29 g/mol. Its IUPAC name is benzene;phenol;prop-2-enoic acid.
Molecular Properties
| Compound Name | benzene;phenol;prop-2-enoic acid |
| PubChem CID | 174875932 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | benzene;phenol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.Oc1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C6H6O.C6H6.C3H4O2/c7-6-4-2-1-3-5-6;1-2-4-6-5-3-1;1-2-3(4)5/h1-5,7H;1-6H;2H,1H2,(H,4,5) |
| InChIKey | UGHADNKFNZNJIB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzene;phenol;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;phenol;prop-2-enoic acid?
The IUPAC name of benzene;phenol;prop-2-enoic acid (CID 174875932) is benzene;phenol;prop-2-enoic acid.
What is the SMILES notation for benzene;phenol;prop-2-enoic acid?
The canonical SMILES for benzene;phenol;prop-2-enoic acid is C=CC(=O)O.Oc1ccccc1.c1ccccc1.
What is the InChIKey of benzene;phenol;prop-2-enoic acid?
The InChIKey is UGHADNKFNZNJIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O.C6H6.C3H4O2/c7-6-4-2-1-3-5-6;1-2-4-6-5-3-1;1-2-3(4)5/h1-5,7H;1-6H;2H,1H2,(H,4,5).
What are the key properties of benzene;phenol;prop-2-enoic acid?
benzene;phenol;prop-2-enoic acid has a molecular weight of 244.29 g/mol, XLogP of 3.34, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;phenol;prop-2-enoic acid is sourced from PubChem (CID 174875932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).