C19H21NO — CID 12031722
N,N-bis[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 12031722) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is N,N-bis[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | N,N-bis[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 12031722 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N,N-bis[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | C=CC(=O)N([C@H](C)c1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H21NO/c1-4-19(21)20(15(2)17-11-7-5-8-12-17)16(3)18-13-9-6-10-14-18/h4-16H,1H2,2-3H3/t15-,16-/m1/s1 |
| InChIKey | WWVKGBMQXURYCB-HZPDHXFCSA-N |
| XLogP | 4.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|