C17H17NO3 — CID 67100741
N,N-bis[hydroxy(phenyl)methyl]prop-2-enamide (PubChem CID 67100741) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is N,N-bis[hydroxy(phenyl)methyl]prop-2-enamide.
| Compound Name | N,N-bis[hydroxy(phenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 67100741 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N,N-bis[hydroxy(phenyl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C(O)c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C17H17NO3/c1-2-15(19)18(16(20)13-9-5-3-6-10-13)17(21)14-11-7-4-8-12-14/h2-12,16-17,20-21H,1H2 |
| InChIKey | MTADAMQYNFCENK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|