C7H13NO3 — CID 22665003
N,N-bis(1-hydroxyethyl)prop-2-enamide (PubChem CID 22665003) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is N,N-bis(1-hydroxyethyl)prop-2-enamide.
| Compound Name | N,N-bis(1-hydroxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 22665003 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | N,N-bis(1-hydroxyethyl)prop-2-enamide |
| SMILES | C=CC(=O)N(C(C)O)C(C)O |
| InChI | InChI=1S/C7H13NO3/c1-4-7(11)8(5(2)9)6(3)10/h4-6,9-10H,1H2,2-3H3 |
| InChIKey | CZJAUOMGCFVCSB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|