C7H14N2O3 — CID 141038532
(3E)-3-ethylidene-1,1-bis(1-hydroxyethyl)urea (PubChem CID 141038532) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is (3E)-3-ethylidene-1,1-bis(1-hydroxyethyl)urea.
| Compound Name | (3E)-3-ethylidene-1,1-bis(1-hydroxyethyl)urea |
|---|---|
| PubChem CID | 141038532 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (3E)-3-ethylidene-1,1-bis(1-hydroxyethyl)urea |
| SMILES | C/C=N/C(=O)N(C(C)O)C(C)O |
| InChI | InChI=1S/C7H14N2O3/c1-4-8-7(12)9(5(2)10)6(3)11/h4-6,10-11H,1-3H3/b8-4+ |
| InChIKey | YKWDTIKTIPORAC-XBXARRHUSA-N |
| XLogP | 0.18 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|