About 1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea
1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea (PubChem CID 174676687) has the molecular formula C14H27N5O4
and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea.
Molecular Properties
| Compound Name | 1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea |
| PubChem CID | 174676687 |
| Molecular Formula | C14H27N5O4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea |
| SMILES | C=CCOCC(O)CN(C(=O)N=CC)C(C)N.CC=NC(N)=O |
| InChI | InChI=1S/C11H21N3O3.C3H6N2O/c1-4-6-17-8-10(15)7-14(9(3)12)11(16)13-5-2;1-2-5-3(4)6/h4-5,9-10,15H,1,6-8,12H2,2-3H3;2H,1H3,(H2,4,6) |
| InChIKey | ZPYFRDKXIUXGCZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea?
The IUPAC name of 1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea (CID 174676687) is 1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea.
What is the SMILES notation for 1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea?
The canonical SMILES for 1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea is C=CCOCC(O)CN(C(=O)N=CC)C(C)N.CC=NC(N)=O.
What is the InChIKey of 1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea?
The InChIKey is ZPYFRDKXIUXGCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O3.C3H6N2O/c1-4-6-17-8-10(15)7-14(9(3)12)11(16)13-5-2;1-2-5-3(4)6/h4-5,9-10,15H,1,6-8,12H2,2-3H3;2H,1H3,(H2,4,6).
What are the key properties of 1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea?
1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea has a molecular weight of 329.40 g/mol, XLogP of 0.52, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-aminoethyl)-3-ethylidene-1-(2-hydroxy-3-prop-2-enoxypropyl)urea;ethylideneurea is sourced from PubChem (CID 174676687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).