C15H28O4 — CID 174357198
(2-hydroxy-3-prop-2-enoxypropyl) 2,2,4,4-tetramethylpentanoate (PubChem CID 174357198) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is (2-hydroxy-3-prop-2-enoxypropyl) 2,2,4,4-tetramethylpentanoate.
| Compound Name | (2-hydroxy-3-prop-2-enoxypropyl) 2,2,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 174357198 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (2-hydroxy-3-prop-2-enoxypropyl) 2,2,4,4-tetramethylpentanoate |
| SMILES | C=CCOCC(O)COC(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C15H28O4/c1-7-8-18-9-12(16)10-19-13(17)15(5,6)11-14(2,3)4/h7,12,16H,1,8-11H2,2-6H3 |
| InChIKey | JEVHTWVMCZYVHD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|