C18H32O5 — CID 121290246
(2-hydroxy-3-prop-2-enoyloxypropyl) 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 121290246) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (2-hydroxy-3-prop-2-enoyloxypropyl) 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | (2-hydroxy-3-prop-2-enoyloxypropyl) 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 121290246 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (2-hydroxy-3-prop-2-enoyloxypropyl) 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | C=CC(=O)OCC(O)COC(=O)C(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H32O5/c1-9-14(20)22-10-13(19)11-23-15(21)18(8,17(5,6)7)12-16(2,3)4/h9,13,19H,1,10-12H2,2-8H3 |
| InChIKey | QELPAESWARDURG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|