C26H40O8 — CID 167065592
6-[1-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxy-3-prop-2-enoyloxypropan-2-yl]oxycarbonylcyclohex-3-ene-1-carboxylic acid (PubChem CID 167065592) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is 6-[1-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxy-3-prop-2-enoyloxypropan-2-yl]oxycarbonylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[1-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxy-3-prop-2-enoyloxypropan-2-yl]oxycarbonylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 167065592 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 6-[1-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxy-3-prop-2-enoyloxypropan-2-yl]oxycarbonylcyclohex-3-ene-1-carboxylic acid |
| SMILES | C=CC(=O)OCC(COC(=O)C(C)(CC(C)(C)C)C(C)(C)C)OC(=O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C26H40O8/c1-9-20(27)32-14-17(34-22(30)19-13-11-10-12-18(19)21(28)29)15-33-23(31)26(8,25(5,6)7)16-24(2,3)4/h9-11,17-19H,1,12-16H2,2-8H3,(H,28,29) |
| InChIKey | WKPMAVCWUJCRFH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|