C20H26O10 — CID 102324178
bis(2-hydroxy-3-prop-2-enoyloxypropyl) cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 102324178) has the molecular formula C20H26O10 and a molecular weight of 426.42 g/mol. Its IUPAC name is bis(2-hydroxy-3-prop-2-enoyloxypropyl) cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | bis(2-hydroxy-3-prop-2-enoyloxypropyl) cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102324178 |
| Molecular Formula | C20H26O10 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | bis(2-hydroxy-3-prop-2-enoyloxypropyl) cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | C=CC(=O)OCC(O)COC(=O)C1CC=CCC1C(=O)OCC(O)COC(=O)C=C |
| InChI | InChI=1S/C20H26O10/c1-3-17(23)27-9-13(21)11-29-19(25)15-7-5-6-8-16(15)20(26)30-12-14(22)10-28-18(24)4-2/h3-6,13-16,21-22H,1-2,7-12H2 |
| InChIKey | FUYOJSOBDMVQJY-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|