C13H18F2O6 — CID 155788262
(4,4-difluoro-2,6-dihydroxy-7-prop-2-enoyloxyheptyl) prop-2-enoate (PubChem CID 155788262) has the molecular formula C13H18F2O6 and a molecular weight of 308.28 g/mol. Its IUPAC name is (4,4-difluoro-2,6-dihydroxy-7-prop-2-enoyloxyheptyl) prop-2-enoate.
| Compound Name | (4,4-difluoro-2,6-dihydroxy-7-prop-2-enoyloxyheptyl) prop-2-enoate |
|---|---|
| PubChem CID | 155788262 |
| Molecular Formula | C13H18F2O6 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (4,4-difluoro-2,6-dihydroxy-7-prop-2-enoyloxyheptyl) prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)CC(F)(F)CC(O)COC(=O)C=C |
| InChI | InChI=1S/C13H18F2O6/c1-3-11(18)20-7-9(16)5-13(14,15)6-10(17)8-21-12(19)4-2/h3-4,9-10,16-17H,1-2,5-8H2 |
| InChIKey | OFSNJKIQWPRLQY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|