C18H18F12O6 — CID 20668058
(4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-2,12-dihydroxy-11-prop-2-enoyloxydodecyl) prop-2-enoate (PubChem CID 20668058) has the molecular formula C18H18F12O6 and a molecular weight of 558.31 g/mol. Its IUPAC name is (4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-2,12-dihydroxy-11-prop-2-enoyloxydodecyl) prop-2-enoate.
| Compound Name | (4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-2,12-dihydroxy-11-prop-2-enoyloxydodecyl) prop-2-enoate |
|---|---|
| PubChem CID | 20668058 |
| Molecular Formula | C18H18F12O6 |
| Molecular Weight | 558.31 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | (4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-2,12-dihydroxy-11-prop-2-enoyloxydodecyl) prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(CO)OC(=O)C=C |
| InChI | InChI=1S/C18H18F12O6/c1-3-11(33)35-8-9(32)5-13(19,20)15(23,24)17(27,28)18(29,30)16(25,26)14(21,22)6-10(7-31)36-12(34)4-2/h3-4,9-10,31-32H,1-2,5-8H2 |
| InChIKey | PFVVXHXRLCKCDG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|