C11H13F3O4 — CID 89335761
(4,4,5-trifluoro-2-prop-2-enoyloxypentyl) prop-2-enoate (PubChem CID 89335761) has the molecular formula C11H13F3O4 and a molecular weight of 266.21 g/mol. Its IUPAC name is (4,4,5-trifluoro-2-prop-2-enoyloxypentyl) prop-2-enoate.
| Compound Name | (4,4,5-trifluoro-2-prop-2-enoyloxypentyl) prop-2-enoate |
|---|---|
| PubChem CID | 89335761 |
| Molecular Formula | C11H13F3O4 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (4,4,5-trifluoro-2-prop-2-enoyloxypentyl) prop-2-enoate |
| SMILES | C=CC(=O)OCC(CC(F)(F)CF)OC(=O)C=C |
| InChI | InChI=1S/C11H13F3O4/c1-3-9(15)17-6-8(18-10(16)4-2)5-11(13,14)7-12/h3-4,8H,1-2,5-7H2 |
| InChIKey | MCWUWFIWYWXCPC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|