C12H16O4S — CID 18431296
(2-prop-2-enoyloxy-6-sulfanylidenehexyl) prop-2-enoate (PubChem CID 18431296) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is (2-prop-2-enoyloxy-6-sulfanylidenehexyl) prop-2-enoate.
| Compound Name | (2-prop-2-enoyloxy-6-sulfanylidenehexyl) prop-2-enoate |
|---|---|
| PubChem CID | 18431296 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (2-prop-2-enoyloxy-6-sulfanylidenehexyl) prop-2-enoate |
| SMILES | C=CC(=O)OCC(CCCC=S)OC(=O)C=C |
| InChI | InChI=1S/C12H16O4S/c1-3-11(13)15-9-10(7-5-6-8-17)16-12(14)4-2/h3-4,8,10H,1-2,5-7,9H2 |
| InChIKey | VYWXSEPLLBNZCE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|