C16H25NO7S — CID 146374436
[9-(methanesulfonamido)-9-oxo-2-prop-2-enoyloxynonyl] prop-2-enoate (PubChem CID 146374436) has the molecular formula C16H25NO7S and a molecular weight of 375.44 g/mol. Its IUPAC name is [9-(methanesulfonamido)-9-oxo-2-prop-2-enoyloxynonyl] prop-2-enoate.
| Compound Name | [9-(methanesulfonamido)-9-oxo-2-prop-2-enoyloxynonyl] prop-2-enoate |
|---|---|
| PubChem CID | 146374436 |
| Molecular Formula | C16H25NO7S |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | [9-(methanesulfonamido)-9-oxo-2-prop-2-enoyloxynonyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(CCCCCCC(=O)NS(C)(=O)=O)OC(=O)C=C |
| InChI | InChI=1S/C16H25NO7S/c1-4-15(19)23-12-13(24-16(20)5-2)10-8-6-7-9-11-14(18)17-25(3,21)22/h4-5,13H,1-2,6-12H2,3H3,(H,17,18) |
| InChIKey | ADAVCDZYVCILCV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|