C12H16F3NO4 — CID 146374385
[2-prop-2-enoyloxy-4-(2,2,2-trifluoroethylamino)butyl] prop-2-enoate (PubChem CID 146374385) has the molecular formula C12H16F3NO4 and a molecular weight of 295.26 g/mol. Its IUPAC name is [2-prop-2-enoyloxy-4-(2,2,2-trifluoroethylamino)butyl] prop-2-enoate.
| Compound Name | [2-prop-2-enoyloxy-4-(2,2,2-trifluoroethylamino)butyl] prop-2-enoate |
|---|---|
| PubChem CID | 146374385 |
| Molecular Formula | C12H16F3NO4 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | [2-prop-2-enoyloxy-4-(2,2,2-trifluoroethylamino)butyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(CCNCC(F)(F)F)OC(=O)C=C |
| InChI | InChI=1S/C12H16F3NO4/c1-3-10(17)19-7-9(20-11(18)4-2)5-6-16-8-12(13,14)15/h3-4,9,16H,1-2,5-8H2 |
| InChIKey | YREVEVZSWWSMNZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|