C24H34O12 — CID 160690637
2,3-di(propanoyloxy)propyl propanoate;2,3-di(prop-2-enoyloxy)propyl prop-2-enoate (PubChem CID 160690637) has the molecular formula C24H34O12 and a molecular weight of 514.52 g/mol. Its IUPAC name is 2,3-di(propanoyloxy)propyl propanoate;2,3-di(prop-2-enoyloxy)propyl prop-2-enoate.
| Compound Name | 2,3-di(propanoyloxy)propyl propanoate;2,3-di(prop-2-enoyloxy)propyl prop-2-enoate |
|---|---|
| PubChem CID | 160690637 |
| Molecular Formula | C24H34O12 |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 2,3-di(propanoyloxy)propyl propanoate;2,3-di(prop-2-enoyloxy)propyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)OC(=O)C=C.CCC(=O)OCC(COC(=O)CC)OC(=O)CC |
| InChI | InChI=1S/C12H20O6.C12H14O6/c2*1-4-10(13)16-7-9(18-12(15)6-3)8-17-11(14)5-2/h9H,4-8H2,1-3H3;4-6,9H,1-3,7-8H2 |
| InChIKey | RPJAAFOHKOIFLS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|