C15H24O6 — CID 123578202
2,3-di(propanoyloxy)propyl hex-3-enoate (PubChem CID 123578202) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2,3-di(propanoyloxy)propyl hex-3-enoate.
| Compound Name | 2,3-di(propanoyloxy)propyl hex-3-enoate |
|---|---|
| PubChem CID | 123578202 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2,3-di(propanoyloxy)propyl hex-3-enoate |
| SMILES | CCC=CCC(=O)OCC(COC(=O)CC)OC(=O)CC |
| InChI | InChI=1S/C15H24O6/c1-4-7-8-9-15(18)20-11-12(21-14(17)6-3)10-19-13(16)5-2/h7-8,12H,4-6,9-11H2,1-3H3 |
| InChIKey | OQPMKLKOCZMQNP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|