C33H50O6 — CID 159752025
methane;[2-[(3Z,6Z)-nona-3,6-dienoyl]oxy-3-[(3Z,6Z)-octa-3,6-dienoyl]oxypropyl] (3Z,6Z,9Z)-dodeca-3,6,9-trienoate (PubChem CID 159752025) has the molecular formula C33H50O6 and a molecular weight of 542.76 g/mol. Its IUPAC name is methane;[2-[(3Z,6Z)-nona-3,6-dienoyl]oxy-3-[(3Z,6Z)-octa-3,6-dienoyl]oxypropyl] (3Z,6Z,9Z)-dodeca-3,6,9-trienoate.
| Compound Name | methane;[2-[(3Z,6Z)-nona-3,6-dienoyl]oxy-3-[(3Z,6Z)-octa-3,6-dienoyl]oxypropyl] (3Z,6Z,9Z)-dodeca-3,6,9-trienoate |
|---|---|
| PubChem CID | 159752025 |
| Molecular Formula | C33H50O6 |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.36 |
| IUPAC Name | methane;[2-[(3Z,6Z)-nona-3,6-dienoyl]oxy-3-[(3Z,6Z)-octa-3,6-dienoyl]oxypropyl] (3Z,6Z,9Z)-dodeca-3,6,9-trienoate |
| SMILES | C.C/C=C\C/C=C\CC(=O)OCC(COC(=O)C/C=C\C/C=C\C/C=C\CC)OC(=O)C/C=C\C/C=C\CC |
| InChI | InChI=1S/C32H46O6.CH4/c1-4-7-10-13-15-16-17-20-22-25-31(34)37-28-29(27-36-30(33)24-21-18-12-9-6-3)38-32(35)26-23-19-14-11-8-5-2;/h6-11,15-16,18-23,29H,4-5,12-14,17,24-28H2,1-3H3;1H4/b9-6-,10-7-,11-8-,16-15-,21-18-,22-20-,23-19-; |
| InChIKey | NDTPTDCHEDUVPX-WUVAVQSDSA-N |
| XLogP | 8.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|