2-methylpropyl 3,4-di(propanoyloxy)butanoate

C14H24O6 — CID 139957342

IUPAC2-methylpropyl 3,4-di(propanoyloxy)butanoate
SMILESCCC(=O)OCC(CC(=O)OCC(C)C)OC(=O)CC
InChIInChI=1S/C14H24O6/c1-5-12(15)19-9-11(20-13(16)6-2)7-14(17)18-8-10(3)4/h10-11H,5-9H2,1-4H3
InChIKeyLTZMPBDMVXCUCV-UHFFFAOYSA-N
MW288.34 g/mol
LogP1.85
Rot. Bonds9

About 2-methylpropyl 3,4-di(propanoyloxy)butanoate

2-methylpropyl 3,4-di(propanoyloxy)butanoate (PubChem CID 139957342) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is 2-methylpropyl 3,4-di(propanoyloxy)butanoate.

Molecular Properties

Compound Name2-methylpropyl 3,4-di(propanoyloxy)butanoate
PubChem CID139957342
Molecular FormulaC14H24O6
Molecular Weight288.34 g/mol
Exact Mass288.16
IUPAC Name2-methylpropyl 3,4-di(propanoyloxy)butanoate
SMILESCCC(=O)OCC(CC(=O)OCC(C)C)OC(=O)CC
InChIInChI=1S/C14H24O6/c1-5-12(15)19-9-11(20-13(16)6-2)7-14(17)18-8-10(3)4/h10-11H,5-9H2,1-4H3
InChIKeyLTZMPBDMVXCUCV-UHFFFAOYSA-N
XLogP1.85
TPSA78.90 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.34
LogP ≤ 51.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}

Analyze 2-methylpropyl 3,4-di(propanoyloxy)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylpropyl 3,4-di(propanoyloxy)butanoate?
The IUPAC name of 2-methylpropyl 3,4-di(propanoyloxy)butanoate (CID 139957342) is 2-methylpropyl 3,4-di(propanoyloxy)butanoate.
What is the SMILES notation for 2-methylpropyl 3,4-di(propanoyloxy)butanoate?
The canonical SMILES for 2-methylpropyl 3,4-di(propanoyloxy)butanoate is CCC(=O)OCC(CC(=O)OCC(C)C)OC(=O)CC.
What is the InChIKey of 2-methylpropyl 3,4-di(propanoyloxy)butanoate?
The InChIKey is LTZMPBDMVXCUCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O6/c1-5-12(15)19-9-11(20-13(16)6-2)7-14(17)18-8-10(3)4/h10-11H,5-9H2,1-4H3.
What are the key properties of 2-methylpropyl 3,4-di(propanoyloxy)butanoate?
2-methylpropyl 3,4-di(propanoyloxy)butanoate has a molecular weight of 288.34 g/mol, XLogP of 1.85, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 3,4-di(propanoyloxy)butanoate is sourced from PubChem (CID 139957342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).