C13H22O6 — CID 121433991
2,3-di(propanoyloxy)propyl 2-methylpropanoate (PubChem CID 121433991) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2,3-di(propanoyloxy)propyl 2-methylpropanoate.
| Compound Name | 2,3-di(propanoyloxy)propyl 2-methylpropanoate |
|---|---|
| PubChem CID | 121433991 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2,3-di(propanoyloxy)propyl 2-methylpropanoate |
| SMILES | CCC(=O)OCC(COC(=O)C(C)C)OC(=O)CC |
| InChI | InChI=1S/C13H22O6/c1-5-11(14)17-7-10(19-12(15)6-2)8-18-13(16)9(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | MIFKZKZJNHMPIO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|