C35H70Cl2O6P2 — CID 10010089
tributyl-[2-[1-(2-methylpropanoyloxy)-3-(2-tributylphosphaniumylacetyl)oxypropan-2-yl]oxy-2-oxoethyl]phosphanium dichloride (PubChem CID 10010089) has the molecular formula C35H70Cl2O6P2 and a molecular weight of 719.79 g/mol. Its IUPAC name is tributyl-[2-[1-(2-methylpropanoyloxy)-3-(2-tributylphosphaniumylacetyl)oxypropan-2-yl]oxy-2-oxoethyl]phosphanium dichloride.
| Compound Name | tributyl-[2-[1-(2-methylpropanoyloxy)-3-(2-tributylphosphaniumylacetyl)oxypropan-2-yl]oxy-2-oxoethyl]phosphanium dichloride |
|---|---|
| PubChem CID | 10010089 |
| Molecular Formula | C35H70Cl2O6P2 |
| Molecular Weight | 719.79 g/mol |
| Exact Mass | 718.40 |
| IUPAC Name | tributyl-[2-[1-(2-methylpropanoyloxy)-3-(2-tributylphosphaniumylacetyl)oxypropan-2-yl]oxy-2-oxoethyl]phosphanium dichloride |
| SMILES | CCCC[P+](CCCC)(CCCC)CC(=O)OCC(COC(=O)C(C)C)OC(=O)C[P+](CCCC)(CCCC)CCCC.[Cl-].[Cl-] |
| InChI | InChI=1S/C35H70O6P2.2ClH/c1-9-15-21-42(22-16-10-2,23-17-11-3)29-33(36)39-27-32(28-40-35(38)31(7)8)41-34(37)30-43(24-18-12-4,25-19-13-5)26-20-14-6;;/h31-32H,9-30H2,1-8H3;2*1H/q+2;;/p-2 |
| InChIKey | USIAPJNAMXSJCC-UHFFFAOYSA-L |
| XLogP | 3.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|