C10H16O6 — CID 90139803
1,3-diacetyloxypropan-2-yl propanoate (PubChem CID 90139803) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is 1,3-diacetyloxypropan-2-yl propanoate.
| Compound Name | 1,3-diacetyloxypropan-2-yl propanoate |
|---|---|
| PubChem CID | 90139803 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1,3-diacetyloxypropan-2-yl propanoate |
| SMILES | CCC(=O)OC(COC(C)=O)COC(C)=O |
| InChI | InChI=1S/C10H16O6/c1-4-10(13)16-9(5-14-7(2)11)6-15-8(3)12/h9H,4-6H2,1-3H3 |
| InChIKey | SMAULKICLQIOLL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|