About 1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate
1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate (PubChem CID 158582642) has the molecular formula C18H32O8
and a molecular weight of 376.45 g/mol. Its IUPAC name is 1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate.
Molecular Properties
| Compound Name | 1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate |
| PubChem CID | 158582642 |
| Molecular Formula | C18H32O8 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate |
| SMILES | CCC(=O)OC(CC)COC(C)=O.CCC(=O)OCC(CC)OC(C)=O |
| InChI | InChI=1S/2C9H16O4/c1-4-8(13-7(3)10)6-12-9(11)5-2;1-4-8(6-12-7(3)10)13-9(11)5-2/h2*8H,4-6H2,1-3H3 |
| InChIKey | HTLCLUUVHLJYTG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate?
The IUPAC name of 1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate (CID 158582642) is 1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate.
What is the SMILES notation for 1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate?
The canonical SMILES for 1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate is CCC(=O)OC(CC)COC(C)=O.CCC(=O)OCC(CC)OC(C)=O.
What is the InChIKey of 1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate?
The InChIKey is HTLCLUUVHLJYTG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H16O4/c1-4-8(13-7(3)10)6-12-9(11)5-2;1-4-8(6-12-7(3)10)13-9(11)5-2/h2*8H,4-6H2,1-3H3.
What are the key properties of 1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate?
1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate has a molecular weight of 376.45 g/mol, XLogP of 2.56, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyloxybutan-2-yl propanoate;2-acetyloxybutyl propanoate is sourced from PubChem (CID 158582642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).