C13H22O6 — CID 122660932
1,3-diacetyloxypropan-2-yl 3,3-dimethylbutanoate (PubChem CID 122660932) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 1,3-diacetyloxypropan-2-yl 3,3-dimethylbutanoate.
| Compound Name | 1,3-diacetyloxypropan-2-yl 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 122660932 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1,3-diacetyloxypropan-2-yl 3,3-dimethylbutanoate |
| SMILES | CC(=O)OCC(COC(C)=O)OC(=O)CC(C)(C)C |
| InChI | InChI=1S/C13H22O6/c1-9(14)17-7-11(8-18-10(2)15)19-12(16)6-13(3,4)5/h11H,6-8H2,1-5H3 |
| InChIKey | UYDQIMXXZSQEJF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|