C16H26O8 — CID 15564984
(2R,3R)-2,3-bis(3,3-dimethylbutanoyloxy)butanedioic acid (PubChem CID 15564984) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is (2R,3R)-2,3-bis(3,3-dimethylbutanoyloxy)butanedioic acid.
| Compound Name | (2R,3R)-2,3-bis(3,3-dimethylbutanoyloxy)butanedioic acid |
|---|---|
| PubChem CID | 15564984 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (2R,3R)-2,3-bis(3,3-dimethylbutanoyloxy)butanedioic acid |
| SMILES | CC(C)(C)CC(=O)O[C@@H](C(=O)O)[C@@H](OC(=O)CC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H26O8/c1-15(2,3)7-9(17)23-11(13(19)20)12(14(21)22)24-10(18)8-16(4,5)6/h11-12H,7-8H2,1-6H3,(H,19,20)(H,21,22)/t11-,12-/m1/s1 |
| InChIKey | BZOYDVZRPPTOLO-VXGBXAGGSA-N |
| XLogP | 1.85 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |