C24H26O26 — CID 138634721
2,3-bis[[3-carboxy-5-(3-carboxy-3-hydroxypropanoyl)oxy-3-hydroxy-5-oxopentanoyl]oxy]butanedioic acid (PubChem CID 138634721) has the molecular formula C24H26O26 and a molecular weight of 730.45 g/mol. Its IUPAC name is 2,3-bis[[3-carboxy-5-(3-carboxy-3-hydroxypropanoyl)oxy-3-hydroxy-5-oxopentanoyl]oxy]butanedioic acid.
| Compound Name | 2,3-bis[[3-carboxy-5-(3-carboxy-3-hydroxypropanoyl)oxy-3-hydroxy-5-oxopentanoyl]oxy]butanedioic acid |
|---|---|
| PubChem CID | 138634721 |
| Molecular Formula | C24H26O26 |
| Molecular Weight | 730.45 g/mol |
| Exact Mass | 730.07 |
| IUPAC Name | 2,3-bis[[3-carboxy-5-(3-carboxy-3-hydroxypropanoyl)oxy-3-hydroxy-5-oxopentanoyl]oxy]butanedioic acid |
| SMILES | O=C(CC(O)C(=O)O)OC(=O)CC(O)(CC(=O)OC(C(=O)O)C(OC(=O)CC(O)(CC(=O)OC(=O)CC(O)C(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H26O26/c25-7(17(33)34)1-9(27)47-11(29)3-23(45,21(41)42)5-13(31)49-15(19(37)38)16(20(39)40)50-14(32)6-24(46,22(43)44)4-12(30)48-10(28)2-8(26)18(35)36/h7-8,15-16,25-26,45-46H,1-6H2,(H,33,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44) |
| InChIKey | ROOMMANJEXYEMU-UHFFFAOYSA-N |
| XLogP | -6.02 |
| TPSA | 444.06 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.45 |
| LogP ≤ 5 | -6.02 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|