C10H12O13S — CID 175331361
2-[2-(3-carboxy-3-sulfopropanoyl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 175331361) has the molecular formula C10H12O13S and a molecular weight of 372.26 g/mol. Its IUPAC name is 2-[2-(3-carboxy-3-sulfopropanoyl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-(3-carboxy-3-sulfopropanoyl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 175331361 |
| Molecular Formula | C10H12O13S |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 2-[2-(3-carboxy-3-sulfopropanoyl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OC(=O)CC(C(=O)O)S(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C10H12O13S/c11-5(12)2-10(19,9(17)18)3-7(14)23-6(13)1-4(8(15)16)24(20,21)22/h4,19H,1-3H2,(H,11,12)(H,15,16)(H,17,18)(H,20,21,22) |
| InChIKey | SZVKLRCMJWQNCM-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 229.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|