C12H18O8 — CID 87570353
2-[2-(3,3-dimethylbutanoyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 87570353) has the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. Its IUPAC name is 2-[2-(3,3-dimethylbutanoyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-(3,3-dimethylbutanoyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 87570353 |
| Molecular Formula | C12H18O8 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-[2-(3,3-dimethylbutanoyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | CC(C)(C)CC(=O)OC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H18O8/c1-11(2,3)5-8(15)20-9(16)6-12(19,10(17)18)4-7(13)14/h19H,4-6H2,1-3H3,(H,13,14)(H,17,18) |
| InChIKey | BNUYVQDWCSRLIY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|