C24H38O10 — CID 87570352
tris(3,3-dimethylbutanoyl) 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 87570352) has the molecular formula C24H38O10 and a molecular weight of 486.56 g/mol. Its IUPAC name is tris(3,3-dimethylbutanoyl) 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | tris(3,3-dimethylbutanoyl) 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 87570352 |
| Molecular Formula | C24H38O10 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | tris(3,3-dimethylbutanoyl) 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CC(C)(C)CC(=O)OC(=O)CC(O)(CC(=O)OC(=O)CC(C)(C)C)C(=O)OC(=O)CC(C)(C)C |
| InChI | InChI=1S/C24H38O10/c1-21(2,3)10-15(25)32-18(28)13-24(31,20(30)34-17(27)12-23(7,8)9)14-19(29)33-16(26)11-22(4,5)6/h31H,10-14H2,1-9H3 |
| InChIKey | SFKZXKLJTYKQLN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|