C14H23NaO8 — CID 174761815
sodium;2-[2-(2,2-diethylbutanoyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid;hydride (PubChem CID 174761815) has the molecular formula C14H23NaO8 and a molecular weight of 342.32 g/mol. Its IUPAC name is sodium;2-[2-(2,2-diethylbutanoyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid;hydride.
| Compound Name | sodium;2-[2-(2,2-diethylbutanoyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid;hydride |
|---|---|
| PubChem CID | 174761815 |
| Molecular Formula | C14H23NaO8 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | sodium;2-[2-(2,2-diethylbutanoyloxy)-2-oxoethyl]-2-hydroxybutanedioic acid;hydride |
| SMILES | CCC(CC)(CC)C(=O)OC(=O)CC(O)(CC(=O)O)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C14H22O8.Na.H/c1-4-13(5-2,6-3)12(20)22-10(17)8-14(21,11(18)19)7-9(15)16;;/h21H,4-8H2,1-3H3,(H,15,16)(H,18,19);;/q;+1;-1 |
| InChIKey | GVTOVJSRBDEXMT-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|