C15H26O8 — CID 21254515
propan-2-one;triethyl 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 21254515) has the molecular formula C15H26O8 and a molecular weight of 334.37 g/mol. Its IUPAC name is propan-2-one;triethyl 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | propan-2-one;triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 21254515 |
| Molecular Formula | C15H26O8 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | propan-2-one;triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CC(C)=O.CCOC(=O)CC(O)(CC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C12H20O7.C3H6O/c1-4-17-9(13)7-12(16,11(15)19-6-3)8-10(14)18-5-2;1-3(2)4/h16H,4-8H2,1-3H3;1-2H3 |
| InChIKey | GOGDAEVSTOKIEM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|