C16H28O9 — CID 88522773
2-methylpropanoic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 88522773) has the molecular formula C16H28O9 and a molecular weight of 364.39 g/mol. Its IUPAC name is 2-methylpropanoic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | 2-methylpropanoic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 88522773 |
| Molecular Formula | C16H28O9 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-methylpropanoic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CC(C)C(=O)O.CCOC(=O)CC(O)(CC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C12H20O7.C4H8O2/c1-4-17-9(13)7-12(16,11(15)19-6-3)8-10(14)18-5-2;1-3(2)4(5)6/h16H,4-8H2,1-3H3;3H,1-2H3,(H,5,6) |
| InChIKey | UMGHSNDKLBDVGG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|