C24H40O14 — CID 87444139
3-ethyl-4-hydroxyheptane-2,3,4-tricarboxylic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 87444139) has the molecular formula C24H40O14 and a molecular weight of 552.57 g/mol. Its IUPAC name is 3-ethyl-4-hydroxyheptane-2,3,4-tricarboxylic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | 3-ethyl-4-hydroxyheptane-2,3,4-tricarboxylic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 87444139 |
| Molecular Formula | C24H40O14 |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 3-ethyl-4-hydroxyheptane-2,3,4-tricarboxylic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CCC(C(=O)O)C(O)(C(=O)O)C(CC)(CC)C(=O)O.CCOC(=O)CC(O)(CC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/2C12H20O7/c1-4-17-9(13)7-12(16,11(15)19-6-3)8-10(14)18-5-2;1-4-7(8(13)14)12(19,10(17)18)11(5-2,6-3)9(15)16/h16H,4-8H2,1-3H3;7,19H,4-6H2,1-3H3,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | DHXFNHQWXMSCBB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 231.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|