C8H12O6 — CID 174526712
2-(2-ethoxy-2-oxoethyl)-2-methylpropanedioic acid (PubChem CID 174526712) has the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. Its IUPAC name is 2-(2-ethoxy-2-oxoethyl)-2-methylpropanedioic acid.
| Compound Name | 2-(2-ethoxy-2-oxoethyl)-2-methylpropanedioic acid |
|---|---|
| PubChem CID | 174526712 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-(2-ethoxy-2-oxoethyl)-2-methylpropanedioic acid |
| SMILES | CCOC(=O)CC(C)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12O6/c1-3-14-5(9)4-8(2,6(10)11)7(12)13/h3-4H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | LKCHETFQMIJPTE-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|